ChemCodeBreakers.org

YHYBNVZCQIDLSQ-UASOIMCYSA-N a

Structure
Molecular formula
C12H16D9F
IUPAC name
1-fluoro(1,2,5,7,8,8,9,11,12-2H9)dodecane
InChI
InChI=1S/C12H25F/c1-2-3-4-5-6-7-8-9-10-11-12-13/h2-12H2,1H3/i1D,2D,4D,5D2,6D,8D,11D,12D
SMILES string
FC([2H])C([2H])CCC([2H])CC([2H])C([2H])([2H])C([2H])CC([2H])C[2H]